C26H26N2O2 — CID 144843136
[(2S,3R,4R)-4-[(4-methoxyanilino)methyl]-3-[4-(2-phenylethynyl)phenyl]azetidin-2-yl]methanol (PubChem CID 144843136) has the molecular formula C26H26N2O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is [(2S,3R,4R)-4-[(4-methoxyanilino)methyl]-3-[4-(2-phenylethynyl)phenyl]azetidin-2-yl]methanol.
| Compound Name | [(2S,3R,4R)-4-[(4-methoxyanilino)methyl]-3-[4-(2-phenylethynyl)phenyl]azetidin-2-yl]methanol |
|---|---|
| PubChem CID | 144843136 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | [(2S,3R,4R)-4-[(4-methoxyanilino)methyl]-3-[4-(2-phenylethynyl)phenyl]azetidin-2-yl]methanol |
| SMILES | COc1ccc(NC[C@@H]2N[C@H](CO)[C@@H]2c2ccc(C#Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H26N2O2/c1-30-23-15-13-22(14-16-23)27-17-24-26(25(18-29)28-24)21-11-9-20(10-12-21)8-7-19-5-3-2-4-6-19/h2-6,9-16,24-29H,17-18H2,1H3/t24-,25+,26+/m0/s1 |
| InChIKey | VQNUVQBQBIPCMT-JIMJEQGWSA-N |
| XLogP | 3.62 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|