C27H32FN5O3 — CID 144843461
ethane;1-(4-fluorophenyl)-6-[4-[formyl(pentyl)amino]phenyl]-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide (PubChem CID 144843461) has the molecular formula C27H32FN5O3 and a molecular weight of 493.58 g/mol. Its IUPAC name is ethane;1-(4-fluorophenyl)-6-[4-[formyl(pentyl)amino]phenyl]-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide.
| Compound Name | ethane;1-(4-fluorophenyl)-6-[4-[formyl(pentyl)amino]phenyl]-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144843461 |
| Molecular Formula | C27H32FN5O3 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | ethane;1-(4-fluorophenyl)-6-[4-[formyl(pentyl)amino]phenyl]-7-oxo-4,5-dihydropyrazolo[5,4-c]pyridine-3-carboxamide |
| SMILES | CC.CCCCCN(C=O)c1ccc(N2CCc3c(C(N)=O)nn(-c4ccc(F)cc4)c3C2=O)cc1 |
| InChI | InChI=1S/C25H26FN5O3.C2H6/c1-2-3-4-14-29(16-32)18-9-11-19(12-10-18)30-15-13-21-22(24(27)33)28-31(23(21)25(30)34)20-7-5-17(26)6-8-20;1-2/h5-12,16H,2-4,13-15H2,1H3,(H2,27,33);1-2H3 |
| InChIKey | LZIBNWPHQRLTGP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|