C25H22F5N5O — CID 144844545
N'-[amino(methyl)amino]-4-[5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-4-fluoro-2-(trifluoromethyl)phenyl]-3-fluorobenzenecarboximidamide (PubChem CID 144844545) has the molecular formula C25H22F5N5O and a molecular weight of 503.48 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-4-[5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-4-fluoro-2-(trifluoromethyl)phenyl]-3-fluorobenzenecarboximidamide.
| Compound Name | N'-[amino(methyl)amino]-4-[5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-4-fluoro-2-(trifluoromethyl)phenyl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 144844545 |
| Molecular Formula | C25H22F5N5O |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N'-[amino(methyl)amino]-4-[5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-4-fluoro-2-(trifluoromethyl)phenyl]-3-fluorobenzenecarboximidamide |
| SMILES | CN(N)/N=C(\N)c1ccc(-c2cc(COc3cc4c(cn3)C3CC3C4)c(F)cc2C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C25H22F5N5O/c1-35(32)34-24(31)12-2-3-16(22(27)7-12)18-6-15(21(26)9-20(18)25(28,29)30)11-36-23-8-14-4-13-5-17(13)19(14)10-33-23/h2-3,6-10,13,17H,4-5,11,32H2,1H3,(H2,31,34) |
| InChIKey | QYNFHXLWTOWXLN-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|