C21H23FN2O — CID 144962455
5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-6-fluoro-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 144962455) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-6-fluoro-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-6-fluoro-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 144962455 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 5-(9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-trien-8-yloxymethyl)-6-fluoro-N,N-dimethyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | CN(C)C1CCc2cc(COc3cc4c(cn3)C3CC3C4)c(F)cc21 |
| InChI | InChI=1S/C21H23FN2O/c1-24(2)20-4-3-12-5-15(19(22)9-17(12)20)11-25-21-8-14-6-13-7-16(13)18(14)10-23-21/h5,8-10,13,16,20H,3-4,6-7,11H2,1-2H3 |
| InChIKey | PJPTVCHCXROYPQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |