C10H8ClFN2O2 — CID 144845693
(Z)-2-amino-4-(3-chloro-4-fluorophenyl)-4-iminobut-2-enoic acid (PubChem CID 144845693) has the molecular formula C10H8ClFN2O2 and a molecular weight of 242.64 g/mol. Its IUPAC name is (Z)-2-amino-4-(3-chloro-4-fluorophenyl)-4-iminobut-2-enoic acid.
| Compound Name | (Z)-2-amino-4-(3-chloro-4-fluorophenyl)-4-iminobut-2-enoic acid |
|---|---|
| PubChem CID | 144845693 |
| Molecular Formula | C10H8ClFN2O2 |
| Molecular Weight | 242.64 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (Z)-2-amino-4-(3-chloro-4-fluorophenyl)-4-iminobut-2-enoic acid |
| SMILES | [H]/N=C(\C=C(/N)C(=O)O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H8ClFN2O2/c11-6-3-5(1-2-7(6)12)8(13)4-9(14)10(15)16/h1-4,13H,14H2,(H,15,16)/b9-4-,13-8+ |
| InChIKey | FHVAEWJLCSEBMG-NTHABNPXSA-N |
| XLogP | 1.77 |
| TPSA | 87.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.64 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|