C24H37BrN6O4 — CID 144847130
tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate;ethane;(3S)-pyrrolidin-3-amine (PubChem CID 144847130) has the molecular formula C24H37BrN6O4 and a molecular weight of 553.50 g/mol. Its IUPAC name is tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate;ethane;(3S)-pyrrolidin-3-amine.
| Compound Name | tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate;ethane;(3S)-pyrrolidin-3-amine |
|---|---|
| PubChem CID | 144847130 |
| Molecular Formula | C24H37BrN6O4 |
| Molecular Weight | 553.50 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | tert-butyl 3-[(6-bromo-3-nitroquinolin-4-yl)amino]pyrrolidine-1-carboxylate;ethane;(3S)-pyrrolidin-3-amine |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)C1.N[C@H]1CCNC1 |
| InChI | InChI=1S/C18H21BrN4O4.C4H10N2.C2H6/c1-18(2,3)27-17(24)22-7-6-12(10-22)21-16-13-8-11(19)4-5-14(13)20-9-15(16)23(25)26;5-4-1-2-6-3-4;1-2/h4-5,8-9,12H,6-7,10H2,1-3H3,(H,20,21);4,6H,1-3,5H2;1-2H3/t;4-;/m.0./s1 |
| InChIKey | FZUMNWONRHYNHF-INZIHYEWSA-N |
| XLogP | 4.66 |
| TPSA | 135.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|