C23H22O5 — CID 144848810
[4-(4-methoxycarbonyl-6-methylcyclohexa-1,3-dien-1-yl)phenyl] 4-methoxybenzoate (PubChem CID 144848810) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is [4-(4-methoxycarbonyl-6-methylcyclohexa-1,3-dien-1-yl)phenyl] 4-methoxybenzoate.
| Compound Name | [4-(4-methoxycarbonyl-6-methylcyclohexa-1,3-dien-1-yl)phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 144848810 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-(4-methoxycarbonyl-6-methylcyclohexa-1,3-dien-1-yl)phenyl] 4-methoxybenzoate |
| SMILES | COC(=O)C1=CC=C(c2ccc(OC(=O)c3ccc(OC)cc3)cc2)C(C)C1 |
| InChI | InChI=1S/C23H22O5/c1-15-14-18(22(24)27-3)8-13-21(15)16-4-11-20(12-5-16)28-23(25)17-6-9-19(26-2)10-7-17/h4-13,15H,14H2,1-3H3 |
| InChIKey | WFGNUDKYLGHYRN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|