C19H22O4 — CID 14484910
6-[3-[3-(2-hydroxyethyl)phenoxy]propyl]-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 14484910) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 6-[3-[3-(2-hydroxyethyl)phenoxy]propyl]-2,3-dihydro-1-benzofuran-5-ol.
| Compound Name | 6-[3-[3-(2-hydroxyethyl)phenoxy]propyl]-2,3-dihydro-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 14484910 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 6-[3-[3-(2-hydroxyethyl)phenoxy]propyl]-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | OCCc1cccc(OCCCc2cc3c(cc2O)CCO3)c1 |
| InChI | InChI=1S/C19H22O4/c20-8-6-14-3-1-5-17(11-14)22-9-2-4-15-13-19-16(7-10-23-19)12-18(15)21/h1,3,5,11-13,20-21H,2,4,6-10H2 |
| InChIKey | MAFZRJRTXXNEDK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|