C20H26N4O4 — CID 144849149
N-[7-(2-morpholin-4-ylethoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]methanimine (PubChem CID 144849149) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[7-(2-morpholin-4-ylethoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]methanimine.
| Compound Name | N-[7-(2-morpholin-4-ylethoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]methanimine |
|---|---|
| PubChem CID | 144849149 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[7-(2-morpholin-4-ylethoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]methanimine |
| SMILES | C=Nc1ncnc2cc(OCCN3CCOCC3)cc(OC3CCOCC3)c12 |
| InChI | InChI=1S/C20H26N4O4/c1-21-20-19-17(22-14-23-20)12-16(27-11-6-24-4-9-26-10-5-24)13-18(19)28-15-2-7-25-8-3-15/h12-15H,1-11H2 |
| InChIKey | WOZWYJSMOBPFMX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|