C22H28N6O4S — CID 118101348
N-[7-(3-morpholin-4-ylpropoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 118101348) has the molecular formula C22H28N6O4S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[7-(3-morpholin-4-ylpropoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[7-(3-morpholin-4-ylpropoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 118101348 |
| Molecular Formula | C22H28N6O4S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[7-(3-morpholin-4-ylpropoxy)-5-(oxan-4-yloxy)quinazolin-4-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | c1nc(Nc2nncs2)c2c(OC3CCOCC3)cc(OCCCN3CCOCC3)cc2n1 |
| InChI | InChI=1S/C22H28N6O4S/c1(4-28-5-10-30-11-6-28)7-31-17-12-18-20(19(13-17)32-16-2-8-29-9-3-16)21(24-14-23-18)26-22-27-25-15-33-22/h12-16H,1-11H2,(H,23,24,26,27) |
| InChIKey | PSBYWUSVYPELHN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|