C23H29ClN6O4 — CID 11488696
N-(5-chloro-2-methoxypyrimidin-4-yl)-7-(3-morpholin-4-ylpropoxy)-5-propan-2-yloxyquinazolin-4-amine (PubChem CID 11488696) has the molecular formula C23H29ClN6O4 and a molecular weight of 488.98 g/mol. Its IUPAC name is N-(5-chloro-2-methoxypyrimidin-4-yl)-7-(3-morpholin-4-ylpropoxy)-5-propan-2-yloxyquinazolin-4-amine.
| Compound Name | N-(5-chloro-2-methoxypyrimidin-4-yl)-7-(3-morpholin-4-ylpropoxy)-5-propan-2-yloxyquinazolin-4-amine |
|---|---|
| PubChem CID | 11488696 |
| Molecular Formula | C23H29ClN6O4 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | N-(5-chloro-2-methoxypyrimidin-4-yl)-7-(3-morpholin-4-ylpropoxy)-5-propan-2-yloxyquinazolin-4-amine |
| SMILES | COc1ncc(Cl)c(Nc2ncnc3cc(OCCCN4CCOCC4)cc(OC(C)C)c23)n1 |
| InChI | InChI=1S/C23H29ClN6O4/c1-15(2)34-19-12-16(33-8-4-5-30-6-9-32-10-7-30)11-18-20(19)22(27-14-26-18)28-21-17(24)13-25-23(29-21)31-3/h11-15H,4-10H2,1-3H3,(H,25,26,27,28,29) |
| InChIKey | SKPQJGSUUJQCDM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|