C27H23FN2O8 — CID 144849759
N-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-fluoropyridine-3-carboxamide (PubChem CID 144849759) has the molecular formula C27H23FN2O8 and a molecular weight of 522.49 g/mol. Its IUPAC name is N-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-fluoropyridine-3-carboxamide.
| Compound Name | N-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 144849759 |
| Molecular Formula | C27H23FN2O8 |
| Molecular Weight | 522.49 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | N-[(5S,5aS,8aR,9R)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-fluoropyridine-3-carboxamide |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC(=O)c3cncc(F)c3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C27H23FN2O8/c1-34-20-4-12(5-21(35-2)25(20)31)22-15-6-18-19(38-11-37-18)7-16(15)24(17-10-36-27(33)23(17)22)30-26(32)13-3-14(28)9-29-8-13/h3-9,17,22-24,31H,10-11H2,1-2H3,(H,30,32)/t17-,22+,23-,24+/m0/s1 |
| InChIKey | JUIPYTSIXPDJSL-QQJYNPJZSA-N |
| XLogP | 3.08 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |