C21H30FN3O5S — CID 144850483
tert-butyl 3-[[2-cyclopropyl-5-fluoro-4-[[methoxysulfanyl(methyl)amino]carbamoyl]phenoxy]methyl]azetidine-1-carboxylate (PubChem CID 144850483) has the molecular formula C21H30FN3O5S and a molecular weight of 455.55 g/mol. Its IUPAC name is tert-butyl 3-[[2-cyclopropyl-5-fluoro-4-[[methoxysulfanyl(methyl)amino]carbamoyl]phenoxy]methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-cyclopropyl-5-fluoro-4-[[methoxysulfanyl(methyl)amino]carbamoyl]phenoxy]methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 144850483 |
| Molecular Formula | C21H30FN3O5S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | tert-butyl 3-[[2-cyclopropyl-5-fluoro-4-[[methoxysulfanyl(methyl)amino]carbamoyl]phenoxy]methyl]azetidine-1-carboxylate |
| SMILES | COSN(C)NC(=O)c1cc(C2CC2)c(OCC2CN(C(=O)OC(C)(C)C)C2)cc1F |
| InChI | InChI=1S/C21H30FN3O5S/c1-21(2,3)30-20(27)25-10-13(11-25)12-29-18-9-17(22)16(8-15(18)14-6-7-14)19(26)23-24(4)31-28-5/h8-9,13-14H,6-7,10-12H2,1-5H3,(H,23,26) |
| InChIKey | NIWBLVIIKPVXBL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|