C8H13NS — CID 144852932
5-[(E)-but-2-en-2-yl]-3,4-dihydro-2H-1,4-thiazine (PubChem CID 144852932) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 5-[(E)-but-2-en-2-yl]-3,4-dihydro-2H-1,4-thiazine.
| Compound Name | 5-[(E)-but-2-en-2-yl]-3,4-dihydro-2H-1,4-thiazine |
|---|---|
| PubChem CID | 144852932 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 5-[(E)-but-2-en-2-yl]-3,4-dihydro-2H-1,4-thiazine |
| SMILES | C/C=C(\C)C1=CSCCN1 |
| InChI | InChI=1S/C8H13NS/c1-3-7(2)8-6-10-5-4-9-8/h3,6,9H,4-5H2,1-2H3/b7-3+ |
| InChIKey | GUYNJECVMYCZCN-XVNBXDOJSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |