C23H32N2O3 — CID 144853235
3-[3-(aminomethyl)phenyl]-N-methylpentan-1-amine;(E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enal (PubChem CID 144853235) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]-N-methylpentan-1-amine;(E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enal.
| Compound Name | 3-[3-(aminomethyl)phenyl]-N-methylpentan-1-amine;(E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enal |
|---|---|
| PubChem CID | 144853235 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]-N-methylpentan-1-amine;(E)-3-[4-hydroxy-3-(hydroxymethyl)phenyl]prop-2-enal |
| SMILES | CCC(CCNC)c1cccc(CN)c1.O=C/C=C/c1ccc(O)c(CO)c1 |
| InChI | InChI=1S/C13H22N2.C10H10O3/c1-3-12(7-8-15-2)13-6-4-5-11(9-13)10-14;11-5-1-2-8-3-4-10(13)9(6-8)7-12/h4-6,9,12,15H,3,7-8,10,14H2,1-2H3;1-6,12-13H,7H2/b;2-1+ |
| InChIKey | MNSALXIVNVPCIX-WLHGVMLRSA-N |
| XLogP | 3.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|