About ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen
ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen (PubChem CID 144853305) has the molecular formula C11H26N2O
and a molecular weight of 202.34 g/mol. Its IUPAC name is ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen |
| PubChem CID | 144853305 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen |
| SMILES | CC.CCC(=O)N1CCC(CNC)C1.[H][H] |
| InChI | InChI=1S/C9H18N2O.C2H6.H2/c1-3-9(12)11-5-4-8(7-11)6-10-2;1-2;/h8,10H,3-7H2,1-2H3;1-2H3;1H |
| InChIKey | QXCVVMMQLDVECP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen?
The IUPAC name of ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen (CID 144853305) is ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen.
What is the SMILES notation for ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen?
The canonical SMILES for ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen is CC.CCC(=O)N1CCC(CNC)C1.[H][H].
What is the InChIKey of ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen?
The InChIKey is QXCVVMMQLDVECP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C2H6.H2/c1-3-9(12)11-5-4-8(7-11)6-10-2;1-2;/h8,10H,3-7H2,1-2H3;1-2H3;1H.
What are the key properties of ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen?
ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen has a molecular weight of 202.34 g/mol, XLogP of 1.74, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[3-(methylaminomethyl)pyrrolidin-1-yl]propan-1-one;molecular hydrogen is sourced from PubChem (CID 144853305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).