C10H15N3 — CID 144853602
3-ethyl-5-methyl-4-[(2E)-penta-2,4-dien-2-yl]-1,2,4-triazole (PubChem CID 144853602) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-ethyl-5-methyl-4-[(2E)-penta-2,4-dien-2-yl]-1,2,4-triazole.
| Compound Name | 3-ethyl-5-methyl-4-[(2E)-penta-2,4-dien-2-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 144853602 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 3-ethyl-5-methyl-4-[(2E)-penta-2,4-dien-2-yl]-1,2,4-triazole |
| SMILES | C=C/C=C(\C)n1c(C)nnc1CC |
| InChI | InChI=1S/C10H15N3/c1-5-7-8(3)13-9(4)11-12-10(13)6-2/h5,7H,1,6H2,2-4H3/b8-7+ |
| InChIKey | GLBOWASINWIYLS-BQYQJAHWSA-N |
| XLogP | 2.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|