About 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole
4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole (PubChem CID 144668193) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole.
Analyze 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole (CID 144668193) is 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole is Cc1nnc(C)n1C1=CCCC=C1.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole?
The InChIKey is HPXJQQODFAUGOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-8-11-12-9(2)13(8)10-6-4-3-5-7-10/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole?
4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole has a molecular weight of 175.23 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-3,5-dimethyl-1,2,4-triazole is sourced from PubChem (CID 144668193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).