C11H9F3N3Y- — CID 59532599
5-methyl-1-(2-methylbenzene-4-id-1-yl)-3-(trifluoromethyl)-1,2,4-triazole;yttrium (PubChem CID 59532599) has the molecular formula C11H9F3N3Y- and a molecular weight of 329.11 g/mol. Its IUPAC name is 5-methyl-1-(2-methylbenzene-4-id-1-yl)-3-(trifluoromethyl)-1,2,4-triazole;yttrium.
| Compound Name | 5-methyl-1-(2-methylbenzene-4-id-1-yl)-3-(trifluoromethyl)-1,2,4-triazole;yttrium |
|---|---|
| PubChem CID | 59532599 |
| Molecular Formula | C11H9F3N3Y- |
| Molecular Weight | 329.11 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 5-methyl-1-(2-methylbenzene-4-id-1-yl)-3-(trifluoromethyl)-1,2,4-triazole;yttrium |
| SMILES | Cc1c[c-]ccc1-n1nc(C(F)(F)F)nc1C.[Y] |
| InChI | InChI=1S/C11H9F3N3.Y/c1-7-5-3-4-6-9(7)17-8(2)15-10(16-17)11(12,13)14;/h4-6H,1-2H3;/q-1; |
| InChIKey | APTKKJICVGIKHZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.11 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|