C16H21N3 — CID 142902860
3,5-dimethyl-4-[(3E,5E,7Z)-5-prop-1-en-2-ylnona-1,3,5,7-tetraen-4-yl]-1,2,4-triazole (PubChem CID 142902860) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3,5-dimethyl-4-[(3E,5E,7Z)-5-prop-1-en-2-ylnona-1,3,5,7-tetraen-4-yl]-1,2,4-triazole.
| Compound Name | 3,5-dimethyl-4-[(3E,5E,7Z)-5-prop-1-en-2-ylnona-1,3,5,7-tetraen-4-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 142902860 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 3,5-dimethyl-4-[(3E,5E,7Z)-5-prop-1-en-2-ylnona-1,3,5,7-tetraen-4-yl]-1,2,4-triazole |
| SMILES | C=C/C=C(C(=C\C=C/C)\C(=C)C)/n1c(C)nnc1C |
| InChI | InChI=1S/C16H21N3/c1-7-9-11-15(12(3)4)16(10-8-2)19-13(5)17-18-14(19)6/h7-11H,2-3H2,1,4-6H3/b9-7-,15-11+,16-10+ |
| InChIKey | XOFZMOSVRMJFQK-GRRAMOLPSA-N |
| XLogP | 4.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|