C42H60O7 — CID 144854090
benzyl (1R,2S,5S,15R,18S,19R)-1,2,8,8,15,19-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricos-11-ene-5-carboxylate (PubChem CID 144854090) has the molecular formula C42H60O7 and a molecular weight of 676.94 g/mol. Its IUPAC name is benzyl (1R,2S,5S,15R,18S,19R)-1,2,8,8,15,19-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricos-11-ene-5-carboxylate.
| Compound Name | benzyl (1R,2S,5S,15R,18S,19R)-1,2,8,8,15,19-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricos-11-ene-5-carboxylate |
|---|---|
| PubChem CID | 144854090 |
| Molecular Formula | C42H60O7 |
| Molecular Weight | 676.94 g/mol |
| Exact Mass | 676.43 |
| IUPAC Name | benzyl (1R,2S,5S,15R,18S,19R)-1,2,8,8,15,19-hexamethyl-18-(3,4,5-trihydroxyoxan-2-yl)oxyhexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricos-11-ene-5-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)OCc3ccccc3)CC[C@]3(C)C(=CCC4[C@@]5(C)CC[C@H](OC6OCC(O)C(O)C6O)[C@]6(C)CC65CC[C@]43C)C2C1 |
| InChI | InChI=1S/C42H60O7/c1-36(2)16-19-41(35(46)48-23-26-10-8-7-9-11-26)20-17-37(3)27(28(41)22-36)12-13-30-38(37,4)18-21-42-25-40(42,6)31(14-15-39(30,42)5)49-34-33(45)32(44)29(43)24-47-34/h7-12,28-34,43-45H,13-25H2,1-6H3/t28?,29?,30?,31-,32?,33?,34?,37+,38+,39+,40-,41-,42?/m0/s1 |
| InChIKey | VAHNYAIQHBJZQG-GZVIDPDFSA-N |
| XLogP | 7.11 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.94 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|