C42H62O7 — CID 166005313
benzyl (4aS,6aR,6aS,6bR,8aR,10S,12aR)-2,2,6a,6b,9,9,12a-heptamethyl-10-(3,4,5-trihydroxyoxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate (PubChem CID 166005313) has the molecular formula C42H62O7 and a molecular weight of 678.95 g/mol. Its IUPAC name is benzyl (4aS,6aR,6aS,6bR,8aR,10S,12aR)-2,2,6a,6b,9,9,12a-heptamethyl-10-(3,4,5-trihydroxyoxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate.
| Compound Name | benzyl (4aS,6aR,6aS,6bR,8aR,10S,12aR)-2,2,6a,6b,9,9,12a-heptamethyl-10-(3,4,5-trihydroxyoxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 166005313 |
| Molecular Formula | C42H62O7 |
| Molecular Weight | 678.95 g/mol |
| Exact Mass | 678.45 |
| IUPAC Name | benzyl (4aS,6aR,6aS,6bR,8aR,10S,12aR)-2,2,6a,6b,9,9,12a-heptamethyl-10-(3,4,5-trihydroxyoxan-2-yl)oxy-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylate |
| SMILES | CC1(C)CC[C@]2(C(=O)OCc3ccccc3)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@H](OC6OCC(O)C(O)C6O)C(C)(C)[C@@H]5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C42H62O7/c1-37(2)19-21-42(36(46)48-24-26-11-9-8-10-12-26)22-20-40(6)27(28(42)23-37)13-14-31-39(5)17-16-32(38(3,4)30(39)15-18-41(31,40)7)49-35-34(45)33(44)29(43)25-47-35/h8-13,28-35,43-45H,14-25H2,1-7H3/t28?,29?,30-,31+,32-,33?,34?,35?,39-,40+,41+,42-/m0/s1 |
| InChIKey | CQDREFSDTPWHJT-KHTGYZIUSA-N |
| XLogP | 7.36 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.95 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|