C11H18FNO2 — CID 144854899
3-[(2Z,4E)-5-fluoro-2-methoxyhexa-2,4-dien-3-yl]oxypyrrolidine (PubChem CID 144854899) has the molecular formula C11H18FNO2 and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-[(2Z,4E)-5-fluoro-2-methoxyhexa-2,4-dien-3-yl]oxypyrrolidine.
| Compound Name | 3-[(2Z,4E)-5-fluoro-2-methoxyhexa-2,4-dien-3-yl]oxypyrrolidine |
|---|---|
| PubChem CID | 144854899 |
| Molecular Formula | C11H18FNO2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-[(2Z,4E)-5-fluoro-2-methoxyhexa-2,4-dien-3-yl]oxypyrrolidine |
| SMILES | CO/C(C)=C(/C=C(\C)F)OC1CCNC1 |
| InChI | InChI=1S/C11H18FNO2/c1-8(12)6-11(9(2)14-3)15-10-4-5-13-7-10/h6,10,13H,4-5,7H2,1-3H3/b8-6+,11-9- |
| InChIKey | PFYLBAIECGSGDA-RVNZKKONSA-N |
| XLogP | 2.12 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|