C27H45FN4 — CID 144857611
N-(4,7-dimethyloctan-4-yl)-2-fluoro-4-propan-2-ylaniline;prop-1-ene;pyrimidin-5-ylmethanamine (PubChem CID 144857611) has the molecular formula C27H45FN4 and a molecular weight of 444.68 g/mol. Its IUPAC name is N-(4,7-dimethyloctan-4-yl)-2-fluoro-4-propan-2-ylaniline;prop-1-ene;pyrimidin-5-ylmethanamine.
| Compound Name | N-(4,7-dimethyloctan-4-yl)-2-fluoro-4-propan-2-ylaniline;prop-1-ene;pyrimidin-5-ylmethanamine |
|---|---|
| PubChem CID | 144857611 |
| Molecular Formula | C27H45FN4 |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | N-(4,7-dimethyloctan-4-yl)-2-fluoro-4-propan-2-ylaniline;prop-1-ene;pyrimidin-5-ylmethanamine |
| SMILES | C=CC.CCCC(C)(CCC(C)C)Nc1ccc(C(C)C)cc1F.NCc1cncnc1 |
| InChI | InChI=1S/C19H32FN.C5H7N3.C3H6/c1-7-11-19(6,12-10-14(2)3)21-18-9-8-16(15(4)5)13-17(18)20;6-1-5-2-7-4-8-3-5;1-3-2/h8-9,13-15,21H,7,10-12H2,1-6H3;2-4H,1,6H2;3H,1H2,2H3 |
| InChIKey | ZEJWWXVSNXPOMP-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|