C24H27FN4O2 — CID 144858757
(E)-3-[2-fluoro-4-[[2-(1H-pyrrolo[2,3-b]pyridin-6-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;(3Z)-penta-1,3-diene (PubChem CID 144858757) has the molecular formula C24H27FN4O2 and a molecular weight of 422.50 g/mol. Its IUPAC name is (E)-3-[2-fluoro-4-[[2-(1H-pyrrolo[2,3-b]pyridin-6-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;(3Z)-penta-1,3-diene.
| Compound Name | (E)-3-[2-fluoro-4-[[2-(1H-pyrrolo[2,3-b]pyridin-6-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 144858757 |
| Molecular Formula | C24H27FN4O2 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | (E)-3-[2-fluoro-4-[[2-(1H-pyrrolo[2,3-b]pyridin-6-yl)ethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.O=C(/C=C/c1ccc(CNCCc2ccc3cc[nH]c3n2)cc1F)NO |
| InChI | InChI=1S/C19H19FN4O2.C5H8/c20-17-11-13(1-2-14(17)4-6-18(25)24-26)12-21-9-8-16-5-3-15-7-10-22-19(15)23-16;1-3-5-4-2/h1-7,10-11,21,26H,8-9,12H2,(H,22,23)(H,24,25);3-5H,1H2,2H3/b6-4+;5-4- |
| InChIKey | RPCMHXSQYMZCEO-ZTOUJPLCSA-N |
| XLogP | 4.30 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|