C30H31Cl2FO3 — CID 144859813
1-(2,6-dichlorophenyl)-2-(2-methylphenyl)prop-2-en-1-one;1,2-dimethylcyclobutane;3-fluoro-4-methylbenzoic acid (PubChem CID 144859813) has the molecular formula C30H31Cl2FO3 and a molecular weight of 529.48 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)prop-2-en-1-one;1,2-dimethylcyclobutane;3-fluoro-4-methylbenzoic acid.
| Compound Name | 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)prop-2-en-1-one;1,2-dimethylcyclobutane;3-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 144859813 |
| Molecular Formula | C30H31Cl2FO3 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-2-(2-methylphenyl)prop-2-en-1-one;1,2-dimethylcyclobutane;3-fluoro-4-methylbenzoic acid |
| SMILES | C=C(C(=O)c1c(Cl)cccc1Cl)c1ccccc1C.CC1CCC1C.Cc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C16H12Cl2O.C8H7FO2.C6H12/c1-10-6-3-4-7-12(10)11(2)16(19)15-13(17)8-5-9-14(15)18;1-5-2-3-6(8(10)11)4-7(5)9;1-5-3-4-6(5)2/h3-9H,2H2,1H3;2-4H,1H3,(H,10,11);5-6H,3-4H2,1-2H3 |
| InChIKey | NJIALEHAZNZGDE-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|