C18H17F3O3S — CID 144861166
[2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate (PubChem CID 144861166) has the molecular formula C18H17F3O3S and a molecular weight of 370.39 g/mol. Its IUPAC name is [2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate.
| Compound Name | [2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 144861166 |
| Molecular Formula | C18H17F3O3S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | [2-[[5-methyl-4-sulfanyl-2-(trifluoromethyl)phenoxy]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1COc1cc(C)c(S)cc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3O3S/c1-3-17(22)24-14-7-5-4-6-12(14)10-23-15-8-11(2)16(25)9-13(15)18(19,20)21/h4-9,25H,3,10H2,1-2H3 |
| InChIKey | OMXMWONFSGHNMY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|