C21H14ClF3O2S — CID 142711953
(4-chlorosulfanyl-2,3-diphenylphenyl) 3,3,3-trifluoropropanoate (PubChem CID 142711953) has the molecular formula C21H14ClF3O2S and a molecular weight of 422.86 g/mol. Its IUPAC name is (4-chlorosulfanyl-2,3-diphenylphenyl) 3,3,3-trifluoropropanoate.
| Compound Name | (4-chlorosulfanyl-2,3-diphenylphenyl) 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 142711953 |
| Molecular Formula | C21H14ClF3O2S |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | (4-chlorosulfanyl-2,3-diphenylphenyl) 3,3,3-trifluoropropanoate |
| SMILES | O=C(CC(F)(F)F)Oc1ccc(SCl)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H14ClF3O2S/c22-28-17-12-11-16(27-18(26)13-21(23,24)25)19(14-7-3-1-4-8-14)20(17)15-9-5-2-6-10-15/h1-12H,13H2 |
| InChIKey | DWVSXMVZSHTXOB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|