C16H14ClF3O4 — CID 144861284
1-chloro-4,5-difluoro-2-[(2-fluoro-6-methoxyphenyl)methoxy]benzene;methyl formate (PubChem CID 144861284) has the molecular formula C16H14ClF3O4 and a molecular weight of 362.73 g/mol. Its IUPAC name is 1-chloro-4,5-difluoro-2-[(2-fluoro-6-methoxyphenyl)methoxy]benzene;methyl formate.
| Compound Name | 1-chloro-4,5-difluoro-2-[(2-fluoro-6-methoxyphenyl)methoxy]benzene;methyl formate |
|---|---|
| PubChem CID | 144861284 |
| Molecular Formula | C16H14ClF3O4 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 1-chloro-4,5-difluoro-2-[(2-fluoro-6-methoxyphenyl)methoxy]benzene;methyl formate |
| SMILES | COC=O.COc1cccc(F)c1COc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C14H10ClF3O2.C2H4O2/c1-19-13-4-2-3-10(16)8(13)7-20-14-6-12(18)11(17)5-9(14)15;1-4-2-3/h2-6H,7H2,1H3;2H,1H3 |
| InChIKey | GAQWBFCYAFVDDU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|