About ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol
ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol (PubChem CID 144861751) has the molecular formula C20H28O3
and a molecular weight of 316.44 g/mol. Its IUPAC name is ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol.
Molecular Properties
| Compound Name | ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol |
| PubChem CID | 144861751 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol |
| SMILES | C=C.Cc1ccccc1CC(C)CO.OC(O)c1ccccc1 |
| InChI | InChI=1S/C11H16O.C7H8O2.C2H4/c1-9(8-12)7-11-6-4-3-5-10(11)2;8-7(9)6-4-2-1-3-5-6;1-2/h3-6,9,12H,7-8H2,1-2H3;1-5,7-9H;1-2H2 |
| InChIKey | KZYLQFUZXUGBED-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol?
The IUPAC name of ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol (CID 144861751) is ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol.
What is the SMILES notation for ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol?
The canonical SMILES for ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol is C=C.Cc1ccccc1CC(C)CO.OC(O)c1ccccc1.
What is the InChIKey of ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol?
The InChIKey is KZYLQFUZXUGBED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C7H8O2.C2H4/c1-9(8-12)7-11-6-4-3-5-10(11)2;8-7(9)6-4-2-1-3-5-6;1-2/h3-6,9,12H,7-8H2,1-2H3;1-5,7-9H;1-2H2.
What are the key properties of ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol?
ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol has a molecular weight of 316.44 g/mol, XLogP of 3.64, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-methyl-3-(2-methylphenyl)propan-1-ol;phenylmethanediol is sourced from PubChem (CID 144861751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).