C29H40N4 — CID 144862241
(5Z,6E)-6-ethylidene-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-[4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine (PubChem CID 144862241) has the molecular formula C29H40N4 and a molecular weight of 444.67 g/mol. Its IUPAC name is (5Z,6E)-6-ethylidene-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-[4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine.
| Compound Name | (5Z,6E)-6-ethylidene-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-[4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine |
|---|---|
| PubChem CID | 144862241 |
| Molecular Formula | C29H40N4 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.33 |
| IUPAC Name | (5Z,6E)-6-ethylidene-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-2-[4-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine |
| SMILES | C=C/C=C1/CN(C(/C=C\C)=C/C=C\C)C(N2CCN(C(/C=C\C)=C/C=C\C)CC2)=N/C1=C/C |
| InChI | InChI=1S/C29H40N4/c1-7-13-18-26(16-10-4)31-20-22-32(23-21-31)29-30-28(12-6)25(15-9-3)24-33(29)27(17-11-5)19-14-8-2/h7-19H,3,20-24H2,1-2,4-6H3/b13-7-,14-8-,16-10-,17-11-,25-15-,26-18+,27-19+,28-12+ |
| InChIKey | SGKZABVJAFVSTP-MDXIOEFDSA-N |
| XLogP | 6.36 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|