C27H36N4 — CID 144862243
(5Z,6E)-6-ethylidene-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine (PubChem CID 144862243) has the molecular formula C27H36N4 and a molecular weight of 416.61 g/mol. Its IUPAC name is (5Z,6E)-6-ethylidene-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine.
| Compound Name | (5Z,6E)-6-ethylidene-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine |
|---|---|
| PubChem CID | 144862243 |
| Molecular Formula | C27H36N4 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | (5Z,6E)-6-ethylidene-3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-[4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-5-prop-2-enylidene-4H-pyrimidine |
| SMILES | C=C/C=C1/CN(/C(C=C)=C/C=C\C)C(N2CCN(/C(C=C)=C/C=C\C)CC2)=N/C1=C/C |
| InChI | InChI=1S/C27H36N4/c1-7-13-16-24(10-4)29-18-20-30(21-19-29)27-28-26(12-6)23(15-9-3)22-31(27)25(11-5)17-14-8-2/h7-17H,3-5,18-22H2,1-2,6H3/b13-7-,14-8-,23-15-,24-16+,25-17+,26-12+ |
| InChIKey | PSZFKLREOXFBOC-MTXJIVNESA-N |
| XLogP | 5.58 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|