C30H41N3O — CID 144862827
2,5-dimethyloctane;ethane;4-[3-formyl-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile (PubChem CID 144862827) has the molecular formula C30H41N3O and a molecular weight of 459.68 g/mol. Its IUPAC name is 2,5-dimethyloctane;ethane;4-[3-formyl-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile.
| Compound Name | 2,5-dimethyloctane;ethane;4-[3-formyl-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 144862827 |
| Molecular Formula | C30H41N3O |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.32 |
| IUPAC Name | 2,5-dimethyloctane;ethane;4-[3-formyl-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
| SMILES | CC.CCCC(C)CCC(C)C.Cc1ccc(-c2cc(C=O)nn2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H13N3O.C10H22.C2H6/c1-13-2-6-15(7-3-13)18-10-16(12-22)20-21(18)17-8-4-14(11-19)5-9-17;1-5-6-10(4)8-7-9(2)3;1-2/h2-10,12H,1H3;9-10H,5-8H2,1-4H3;1-2H3 |
| InChIKey | JHDQWPRQBDJQJE-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|