C27H31N3O — CID 145029463
4-[3-[2-(4-ethylcyclohexyl)ethoxy]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile (PubChem CID 145029463) has the molecular formula C27H31N3O and a molecular weight of 413.57 g/mol. Its IUPAC name is 4-[3-[2-(4-ethylcyclohexyl)ethoxy]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile.
| Compound Name | 4-[3-[2-(4-ethylcyclohexyl)ethoxy]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 145029463 |
| Molecular Formula | C27H31N3O |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 4-[3-[2-(4-ethylcyclohexyl)ethoxy]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
| SMILES | CCC1CCC(CCOc2cc(-c3ccc(C)cc3)n(-c3ccc(C#N)cc3)n2)CC1 |
| InChI | InChI=1S/C27H31N3O/c1-3-21-6-8-22(9-7-21)16-17-31-27-18-26(24-12-4-20(2)5-13-24)30(29-27)25-14-10-23(19-28)11-15-25/h4-5,10-15,18,21-22H,3,6-9,16-17H2,1-2H3 |
| InChIKey | XQIZFZSWQVRVAX-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |