C32H41NO3P+ — CID 144863488
[6-[3-(butylamino)-2-methyl-3-oxopropoxy]-6-oxohexyl]-triphenylphosphanium (PubChem CID 144863488) has the molecular formula C32H41NO3P+ and a molecular weight of 518.66 g/mol. Its IUPAC name is [6-[3-(butylamino)-2-methyl-3-oxopropoxy]-6-oxohexyl]-triphenylphosphanium.
| Compound Name | [6-[3-(butylamino)-2-methyl-3-oxopropoxy]-6-oxohexyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 144863488 |
| Molecular Formula | C32H41NO3P+ |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | [6-[3-(butylamino)-2-methyl-3-oxopropoxy]-6-oxohexyl]-triphenylphosphanium |
| SMILES | CCCCNC(=O)C(C)COC(=O)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40NO3P/c1-3-4-24-33-32(35)27(2)26-36-31(34)23-15-8-16-25-37(28-17-9-5-10-18-28,29-19-11-6-12-20-29)30-21-13-7-14-22-30/h5-7,9-14,17-22,27H,3-4,8,15-16,23-26H2,1-2H3/p+1 |
| InChIKey | BSWFFZDNPWHETA-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|