C55H61NO5P2S+2 — CID 145014432
[6-[2-methyl-3-oxo-3-(2-sulfanylideneethylamino)-2-(6-triphenylphosphaniumylhexanoyloxymethyl)propoxy]-6-oxohexyl]-triphenylphosphanium (PubChem CID 145014432) has the molecular formula C55H61NO5P2S+2 and a molecular weight of 910.11 g/mol. Its IUPAC name is [6-[2-methyl-3-oxo-3-(2-sulfanylideneethylamino)-2-(6-triphenylphosphaniumylhexanoyloxymethyl)propoxy]-6-oxohexyl]-triphenylphosphanium.
| Compound Name | [6-[2-methyl-3-oxo-3-(2-sulfanylideneethylamino)-2-(6-triphenylphosphaniumylhexanoyloxymethyl)propoxy]-6-oxohexyl]-triphenylphosphanium |
|---|---|
| PubChem CID | 145014432 |
| Molecular Formula | C55H61NO5P2S+2 |
| Molecular Weight | 910.11 g/mol |
| Exact Mass | 909.37 |
| IUPAC Name | [6-[2-methyl-3-oxo-3-(2-sulfanylideneethylamino)-2-(6-triphenylphosphaniumylhexanoyloxymethyl)propoxy]-6-oxohexyl]-triphenylphosphanium |
| SMILES | CC(COC(=O)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)(COC(=O)CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)NCC=S |
| InChI | InChI=1S/C55H60NO5P2S/c1-55(54(59)56-40-43-64,44-60-52(57)38-22-8-24-41-62(46-26-10-2-11-27-46,47-28-12-3-13-29-47)48-30-14-4-15-31-48)45-61-53(58)39-23-9-25-42-63(49-32-16-5-17-33-49,50-34-18-6-19-35-50)51-36-20-7-21-37-51/h2-7,10-21,26-37,43H,8-9,22-25,38-42,44-45H2,1H3/q+1/p+1 |
| InChIKey | AVDQWNPFXORJJQ-UHFFFAOYSA-O |
| XLogP | 9.30 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.11 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|