C25H29F3N6O2 — CID 144865192
N-[2-[2-[4-(but-3-enylamino)piperidin-1-yl]-2-oxoethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen (PubChem CID 144865192) has the molecular formula C25H29F3N6O2 and a molecular weight of 502.54 g/mol. Its IUPAC name is N-[2-[2-[4-(but-3-enylamino)piperidin-1-yl]-2-oxoethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen.
| Compound Name | N-[2-[2-[4-(but-3-enylamino)piperidin-1-yl]-2-oxoethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 144865192 |
| Molecular Formula | C25H29F3N6O2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-[2-[2-[4-(but-3-enylamino)piperidin-1-yl]-2-oxoethyl]indazol-5-yl]-6-(trifluoromethyl)pyridine-2-carboxamide;molecular hydrogen |
| SMILES | C=CCCNC1CCN(C(=O)Cn2cc3cc(NC(=O)c4cccc(C(F)(F)F)n4)ccc3n2)CC1.[H][H] |
| InChI | InChI=1S/C25H27F3N6O2.H2/c1-2-3-11-29-18-9-12-33(13-10-18)23(35)16-34-15-17-14-19(7-8-20(17)32-34)30-24(36)21-5-4-6-22(31-21)25(26,27)28;/h2,4-8,14-15,18,29H,1,3,9-13,16H2,(H,30,36);1H |
| InChIKey | UXOUXXBSCFPMLB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|