C29H32N6O — CID 144866306
4-[(1R,3S,5R,6R)-1-[1-propan-2-yl-3-[1-(pyridin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]pyrazol-5-yl]-3-tricyclo[3.1.0.02,6]hexanyl]morpholine (PubChem CID 144866306) has the molecular formula C29H32N6O and a molecular weight of 480.62 g/mol. Its IUPAC name is 4-[(1R,3S,5R,6R)-1-[1-propan-2-yl-3-[1-(pyridin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]pyrazol-5-yl]-3-tricyclo[3.1.0.02,6]hexanyl]morpholine.
| Compound Name | 4-[(1R,3S,5R,6R)-1-[1-propan-2-yl-3-[1-(pyridin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]pyrazol-5-yl]-3-tricyclo[3.1.0.02,6]hexanyl]morpholine |
|---|---|
| PubChem CID | 144866306 |
| Molecular Formula | C29H32N6O |
| Molecular Weight | 480.62 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 4-[(1R,3S,5R,6R)-1-[1-propan-2-yl-3-[1-(pyridin-2-ylmethyl)pyrrolo[3,2-b]pyridin-6-yl]pyrazol-5-yl]-3-tricyclo[3.1.0.02,6]hexanyl]morpholine |
| SMILES | CC(C)n1nc(-c2cnc3ccn(Cc4ccccn4)c3c2)cc1[C@]12C3C(N4CCOCC4)C[C@@H]1[C@H]32 |
| InChI | InChI=1S/C29H32N6O/c1-18(2)35-26(29-21-14-25(28(29)27(21)29)33-9-11-36-12-10-33)15-23(32-35)19-13-24-22(31-16-19)6-8-34(24)17-20-5-3-4-7-30-20/h3-8,13,15-16,18,21,25,27-28H,9-12,14,17H2,1-2H3/t21-,25?,27-,28?,29-/m1/s1 |
| InChIKey | ZKHCCVGELGLLIZ-PRFPVBFHSA-N |
| XLogP | 4.14 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.62 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |