C10H13FO2 — CID 144869305
(2E,4E)-4-(fluoromethyl)-2-prop-1-en-2-ylhexa-2,4-dienoic acid (PubChem CID 144869305) has the molecular formula C10H13FO2 and a molecular weight of 184.21 g/mol. Its IUPAC name is (2E,4E)-4-(fluoromethyl)-2-prop-1-en-2-ylhexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-4-(fluoromethyl)-2-prop-1-en-2-ylhexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 144869305 |
| Molecular Formula | C10H13FO2 |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | (2E,4E)-4-(fluoromethyl)-2-prop-1-en-2-ylhexa-2,4-dienoic acid |
| SMILES | C=C(C)/C(=C\C(=C/C)CF)C(=O)O |
| InChI | InChI=1S/C10H13FO2/c1-4-8(6-11)5-9(7(2)3)10(12)13/h4-5H,2,6H2,1,3H3,(H,12,13)/b8-4+,9-5+ |
| InChIKey | LVCGEUBTGFAZIF-KBXRYBNXSA-N |
| XLogP | 2.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|