C17H15F3N4O3 — CID 144869431
(Z)-1-hydrazinyl-3-[[5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-yl]oxy]prop-1-en-2-amine (PubChem CID 144869431) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is (Z)-1-hydrazinyl-3-[[5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-yl]oxy]prop-1-en-2-amine.
| Compound Name | (Z)-1-hydrazinyl-3-[[5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-yl]oxy]prop-1-en-2-amine |
|---|---|
| PubChem CID | 144869431 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (Z)-1-hydrazinyl-3-[[5-[4-(trifluoromethoxy)phenyl]-1,2-benzoxazol-3-yl]oxy]prop-1-en-2-amine |
| SMILES | NN/C=C(\N)COc1noc2ccc(-c3ccc(OC(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C17H15F3N4O3/c18-17(19,20)26-13-4-1-10(2-5-13)11-3-6-15-14(7-11)16(24-27-15)25-9-12(21)8-23-22/h1-8,23H,9,21-22H2/b12-8- |
| InChIKey | WHODSQJRBOTKOM-WQLSENKSSA-N |
| XLogP | 3.04 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|