C20H21FN4O3 — CID 144869521
[5-[4-(1-amino-1-fluoroethoxy)phenyl]-1,2-benzoxazol-3-yl] N'-methyl-N-[(Z)-prop-1-enyl]carbamimidate (PubChem CID 144869521) has the molecular formula C20H21FN4O3 and a molecular weight of 384.41 g/mol. Its IUPAC name is [5-[4-(1-amino-1-fluoroethoxy)phenyl]-1,2-benzoxazol-3-yl] N'-methyl-N-[(Z)-prop-1-enyl]carbamimidate.
| Compound Name | [5-[4-(1-amino-1-fluoroethoxy)phenyl]-1,2-benzoxazol-3-yl] N'-methyl-N-[(Z)-prop-1-enyl]carbamimidate |
|---|---|
| PubChem CID | 144869521 |
| Molecular Formula | C20H21FN4O3 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [5-[4-(1-amino-1-fluoroethoxy)phenyl]-1,2-benzoxazol-3-yl] N'-methyl-N-[(Z)-prop-1-enyl]carbamimidate |
| SMILES | C/C=C\N/C(=N\C)Oc1noc2ccc(-c3ccc(OC(C)(N)F)cc3)cc12 |
| InChI | InChI=1S/C20H21FN4O3/c1-4-11-24-19(23-3)26-18-16-12-14(7-10-17(16)28-25-18)13-5-8-15(9-6-13)27-20(2,21)22/h4-12H,22H2,1-3H3,(H,23,24)/b11-4- |
| InChIKey | GGESINJPCRJVMR-WCIBSUBMSA-N |
| XLogP | 3.96 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|