C11H17N3 — CID 144869732
ethane;3,4,6-trimethyl-2H-pyrazolo[4,3-c]pyridine (PubChem CID 144869732) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is ethane;3,4,6-trimethyl-2H-pyrazolo[4,3-c]pyridine.
| Compound Name | ethane;3,4,6-trimethyl-2H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 144869732 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | ethane;3,4,6-trimethyl-2H-pyrazolo[4,3-c]pyridine |
| SMILES | CC.Cc1cc2n[nH]c(C)c2c(C)n1 |
| InChI | InChI=1S/C9H11N3.C2H6/c1-5-4-8-9(6(2)10-5)7(3)11-12-8;1-2/h4H,1-3H3,(H,11,12);1-2H3 |
| InChIKey | HRTVJLBPDATKAF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |