About 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen
3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen (PubChem CID 144598952) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen.
Analyze 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen?
The IUPAC name of 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen (CID 144598952) is 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen.
What is the SMILES notation for 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen?
The canonical SMILES for 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen is Cc1cc2n[nH]c(C)c2cn1.[H][H].
What is the InChIKey of 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen?
The InChIKey is ZWTKPMCSKQISMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.H2/c1-5-3-8-7(4-9-5)6(2)10-11-8;/h3-4H,1-2H3,(H,10,11);1H.
What are the key properties of 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen?
3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen has a molecular weight of 149.20 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2H-pyrazolo[4,3-c]pyridine;molecular hydrogen is sourced from PubChem (CID 144598952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).