C11H15BrN2 — CID 178017805
6-bromo-3,5-dimethyl-2H-indazole;ethane (PubChem CID 178017805) has the molecular formula C11H15BrN2 and a molecular weight of 255.16 g/mol. Its IUPAC name is 6-bromo-3,5-dimethyl-2H-indazole;ethane.
| Compound Name | 6-bromo-3,5-dimethyl-2H-indazole;ethane |
|---|---|
| PubChem CID | 178017805 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 6-bromo-3,5-dimethyl-2H-indazole;ethane |
| SMILES | CC.Cc1cc2c(C)[nH]nc2cc1Br |
| InChI | InChI=1S/C9H9BrN2.C2H6/c1-5-3-7-6(2)11-12-9(7)4-8(5)10;1-2/h3-4H,1-2H3,(H,11,12);1-2H3 |
| InChIKey | DCDTVGDTNWHIGM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |