C16H31N3O6 — CID 144870682
ethane;2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea (PubChem CID 144870682) has the molecular formula C16H31N3O6 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethane;2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea.
| Compound Name | ethane;2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea |
|---|---|
| PubChem CID | 144870682 |
| Molecular Formula | C16H31N3O6 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | ethane;2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea |
| SMILES | CC.CCCNC(N)=O.CCOC(=O)C1(C(=O)NCC(=O)O)CCC1 |
| InChI | InChI=1S/C10H15NO5.C4H10N2O.C2H6/c1-2-16-9(15)10(4-3-5-10)8(14)11-6-7(12)13;1-2-3-6-4(5)7;1-2/h2-6H2,1H3,(H,11,14)(H,12,13);2-3H2,1H3,(H3,5,6,7);1-2H3 |
| InChIKey | CFZDNSVLFDDPIP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|