C14H25N3O6 — CID 144870742
2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea (PubChem CID 144870742) has the molecular formula C14H25N3O6 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea.
| Compound Name | 2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea |
|---|---|
| PubChem CID | 144870742 |
| Molecular Formula | C14H25N3O6 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-[(1-ethoxycarbonylcyclobutanecarbonyl)amino]acetic acid;propylurea |
| SMILES | CCCNC(N)=O.CCOC(=O)C1(C(=O)NCC(=O)O)CCC1 |
| InChI | InChI=1S/C10H15NO5.C4H10N2O/c1-2-16-9(15)10(4-3-5-10)8(14)11-6-7(12)13;1-2-3-6-4(5)7/h2-6H2,1H3,(H,11,14)(H,12,13);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | ZLNKAVWVHGUMAY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|