C31H38N4O7 — CID 144871907
methyl (1R,20R,24S,27S)-24-tert-butyl-7-methoxy-22,25-dioxo-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.117,20.03,12.05,10]triaconta-3,5(10),6,8,11-pentaen-13-yne-27-carboxylate (PubChem CID 144871907) has the molecular formula C31H38N4O7 and a molecular weight of 578.67 g/mol. Its IUPAC name is methyl (1R,20R,24S,27S)-24-tert-butyl-7-methoxy-22,25-dioxo-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.117,20.03,12.05,10]triaconta-3,5(10),6,8,11-pentaen-13-yne-27-carboxylate.
| Compound Name | methyl (1R,20R,24S,27S)-24-tert-butyl-7-methoxy-22,25-dioxo-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.117,20.03,12.05,10]triaconta-3,5(10),6,8,11-pentaen-13-yne-27-carboxylate |
|---|---|
| PubChem CID | 144871907 |
| Molecular Formula | C31H38N4O7 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | methyl (1R,20R,24S,27S)-24-tert-butyl-7-methoxy-22,25-dioxo-2,21-dioxa-4,11,23,26-tetrazapentacyclo[24.2.1.117,20.03,12.05,10]triaconta-3,5(10),6,8,11-pentaen-13-yne-27-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1CCC(CCC#Cc3nc4ccc(OC)cc4nc3O2)C1 |
| InChI | InChI=1S/C31H38N4O7/c1-31(2,3)26-28(36)35-17-21(16-25(35)29(37)40-5)41-27-23(32-22-13-12-19(39-4)15-24(22)33-27)9-7-6-8-18-10-11-20(14-18)42-30(38)34-26/h12-13,15,18,20-21,25-26H,6,8,10-11,14,16-17H2,1-5H3,(H,34,38)/t18?,20-,21-,25+,26-/m1/s1 |
| InChIKey | PFIJNVFTWYNLRM-PVFQINDKSA-N |
| XLogP | 3.61 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|