C21H20F7N3O6S — CID 144872867
1,1,1,3,3,3-hexafluoropropan-2-yl N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate;N-methylacetamide (PubChem CID 144872867) has the molecular formula C21H20F7N3O6S and a molecular weight of 575.46 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate;N-methylacetamide.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate;N-methylacetamide |
|---|---|
| PubChem CID | 144872867 |
| Molecular Formula | C21H20F7N3O6S |
| Molecular Weight | 575.46 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate;N-methylacetamide |
| SMILES | CNC(C)=O.O=C(Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCO2)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H13F7N2O5S.C3H7NO/c19-10-1-4-12(5-2-10)33(29,30)27-7-8-31-14-6-3-11(9-13(14)27)26-16(28)32-15(17(20,21)22)18(23,24)25;1-3(5)4-2/h1-6,9,15H,7-8H2,(H,26,28);1-2H3,(H,4,5) |
| InChIKey | SJLAXGNFAWFXCE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |