C28H38F4N4O6S — CID 144873627
N-cyclohexylformamide;N-methylmethanamine;(1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 144873627) has the molecular formula C28H38F4N4O6S and a molecular weight of 634.69 g/mol. Its IUPAC name is N-cyclohexylformamide;N-methylmethanamine;(1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | N-cyclohexylformamide;N-methylmethanamine;(1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 144873627 |
| Molecular Formula | C28H38F4N4O6S |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | N-cyclohexylformamide;N-methylmethanamine;(1,1,1-trifluoro-2-methylpropan-2-yl) N-[4-(4-fluorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(C)(OC(=O)Nc1ccc2c(c1)N(S(=O)(=O)c1ccc(F)cc1)CCO2)C(F)(F)F.CNC.O=CNC1CCCCC1 |
| InChI | InChI=1S/C19H18F4N2O5S.C7H13NO.C2H7N/c1-18(2,19(21,22)23)30-17(26)24-13-5-8-16-15(11-13)25(9-10-29-16)31(27,28)14-6-3-12(20)4-7-14;9-6-8-7-4-2-1-3-5-7;1-3-2/h3-8,11H,9-10H2,1-2H3,(H,24,26);6-7H,1-5H2,(H,8,9);3H,1-2H3 |
| InChIKey | VQODMLNXEJCMGD-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|