C22H27FN2O4S — CID 144873606
tert-butyl N-[(2S)-4-(4-fluorophenyl)sulfanyl-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate (PubChem CID 144873606) has the molecular formula C22H27FN2O4S and a molecular weight of 434.53 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(4-fluorophenyl)sulfanyl-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-(4-fluorophenyl)sulfanyl-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
|---|---|
| PubChem CID | 144873606 |
| Molecular Formula | C22H27FN2O4S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | tert-butyl N-[(2S)-4-(4-fluorophenyl)sulfanyl-2-(2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-6-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(c1)N(Sc1ccc(F)cc1)C[C@@H](C(C)(C)O)O2 |
| InChI | InChI=1S/C22H27FN2O4S/c1-21(2,3)29-20(26)24-15-8-11-18-17(12-15)25(13-19(28-18)22(4,5)27)30-16-9-6-14(23)7-10-16/h6-12,19,27H,13H2,1-5H3,(H,24,26)/t19-/m0/s1 |
| InChIKey | ALXDZGSEROGQND-IBGZPJMESA-N |
| XLogP | 5.22 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|